Products 31792-47-9
CAS 31792-47-9 appears in our catalog under these names: 2-Thiophen-2-yl-quinoline-4-carboxylic acid, 95%, 2-(Thiophen-2-yl)quinoline-4-carboxylic acid 95%, 2-Thiophen-2-yl-quinoline-4-carboxylic acid, 95%, 95%, 2-Thiophen-2-ylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-thiophen-2-ylquinoline-4-carboxylic acid (CAS 31792-47-9) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 2-thiophen-2-ylquinoline-4-carboxylic acid. InChIKey: YDZHUFHFHQWQQB-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-thiophen-2-ylquinoline-4-carboxylic acid |
| InChIKey | YDZHUFHFHQWQQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CC=CS3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(thiophen-2-yl)quinoline-4-carboxylic acid, 2-Thiophen-2-yl-quinoline-4-carboxylic acid, 2-(2-thienyl)quinoline-4-carboxylic acid, 2-thiophen-2-ylquinoline-4-carboxylic acid, 2-(2-Thienyl)-4-quinolinecarboxylic acid, 2-thien-2-ylquinoline-4-carboxylic acid, 2-[2-Thienyl]cinchoninic acid, Enamine_001347, CBMicro_024213, Cambridge id 5403248