CAS 20000-52-6 is the registry number for 3-(Benzo[d]thiazol-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-(1,3-benzothiazol-2-yl)benzoic acid (CAS 20000-52-6) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)benzoic acid. InChIKey: JGHJRMOIZBCSIN-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-yl)benzoic acid |
| InChIKey | JGHJRMOIZBCSIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)