CAS 57372-27-7 is the registry number for 2-(Naphthalen-2-yl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-naphthalen-2-yl-1,3-thiazole-4-carboxylic acid (CAS 57372-27-7) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 2-naphthalen-2-yl-1,3-thiazole-4-carboxylic acid. InChIKey: SORZSBORLXFHFY-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-naphthalen-2-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | SORZSBORLXFHFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)