CAS 215712-28-0 is the registry number for 2-(Naphthalen-1-yl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-naphthalen-1-yl-1,3-thiazole-4-carboxylic acid (CAS 215712-28-0) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 2-naphthalen-1-yl-1,3-thiazole-4-carboxylic acid. InChIKey: AQRUWPVKXHZCKR-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-naphthalen-1-yl-1,3-thiazole-4-carboxylic acid |
| InChIKey | AQRUWPVKXHZCKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC(=CS3)C(=O)O |
Computed by PubChem (NCBI)