CAS 14204-27-4 appears in our catalog under these names: N–(Phenylthio)phthalimide, N-(Phenylthio)phthalimide, >98.0%(GC)(N), 2-(Phenylthio)isoindoline-1,3-dione 95%, 2-(Phenylthio)isoindoline-1,3-dione, 95%, 95%, 2-(Phenylthio)isoindoline-1,3-dione, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 500g, 250mg, 100g, 10g.
2-phenylsulfanylisoindole-1,3-dione (CAS 14204-27-4) is a chemical compound with the molecular formula C14H9NO2S and a molecular weight of 255.29 g/mol. IUPAC name: 2-phenylsulfanylisoindole-1,3-dione. InChIKey: NMHKBABHRKQHOL-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-phenylsulfanylisoindole-1,3-dione |
| InChIKey | NMHKBABHRKQHOL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)