CAS 1019523-55-7 is the registry number for 1-(2,4-Dichlorophenyl)-N-(pyridin-3-ylmethyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)ethanamine (CAS 1019523-55-7) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)ethanamine. InChIKey: OJWXYTHTPRZVEZ-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-N-(pyridin-3-ylmethyl)ethanamine |
| InChIKey | OJWXYTHTPRZVEZ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)NCC2=CN=CC=C2 |
Computed by PubChem (NCBI)