Products 86212-34-2
CAS 86212-34-2 appears in our catalog under these names: 1,2-Bis(4-chlorophenyl)ethane-1,2-diamine, 95%, 1，2–Bis(4–chlorophenyl)ethane–1，2–diamine, 1,2-Bis(4-chlorophenyl)ethane-1,2-diamine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg.
1,2-bis(4-chlorophenyl)ethane-1,2-diamine (CAS 86212-34-2) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: 1,2-bis(4-chlorophenyl)ethane-1,2-diamine. InChIKey: HHPPUZSHKRJDIW-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 1,2-bis(4-chlorophenyl)ethane-1,2-diamine |
| InChIKey | HHPPUZSHKRJDIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(C2=CC=C(C=C2)Cl)N)N)Cl |
Computed by PubChem (NCBI)