Products 63111-28-4
CAS 63111-28-4 is the registry number for 1-((4-Chlorophenyl)methyl)-2,3-dihydroimidazo(1,2-a)pyridinium Chloride. Offered by: Mikromol. Available pack sizes: 4x25mg, 25mg.
1-[(4-chlorophenyl)methyl]-2,3-dihydroimidazo[1,2-a]pyridin-4-ium chloride (CAS 63111-28-4) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-2,3-dihydroimidazo[1,2-a]pyridin-4-ium chloride. InChIKey: IVVQBHCLPSZZKR-UHFFFAOYSA-M.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-2,3-dihydroimidazo[1,2-a]pyridin-4-ium chloride |
| InChIKey | IVVQBHCLPSZZKR-UHFFFAOYSA-M |
| SMILES | C1C[N+]2=CC=CC=C2N1CC3=CC=C(C=C3)Cl.[Cl-] |
Computed by PubChem (NCBI)