CAS 822519-90-4 appears in our catalog under these names: (1R,2R)-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine, 97%, (1R,2R)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine, ≥97%(HPLC),≥99%(ee), ≥97%(HPLC),≥99%(ee). Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 500mg, 1g.
(1R,2R)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine (CAS 822519-90-4) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: (1R,2R)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine. InChIKey: HHPPUZSHKRJDIW-ZIAGYGMSSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine |
| InChIKey | HHPPUZSHKRJDIW-ZIAGYGMSSA-N |
| SMILES | C1=CC(=CC=C1[C@H]([C@@H](C2=CC=C(C=C2)Cl)N)N)Cl |
Computed by PubChem (NCBI)