CAS 192214-40-7 is the registry number for (1S,2S)-1,2-Bis(4-chlorophenyl)ethane-1,2-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine (CAS 192214-40-7) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: (1S,2S)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine. InChIKey: HHPPUZSHKRJDIW-KBPBESRZSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | (1S,2S)-1,2-bis(4-chlorophenyl)ethane-1,2-diamine |
| InChIKey | HHPPUZSHKRJDIW-KBPBESRZSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]([C@H](C2=CC=C(C=C2)Cl)N)N)Cl |
Computed by PubChem (NCBI)