CAS 1304390-10-0 appears in our catalog under these names: ((2,4-Dichlorophenyl)(pyridin-3-yl)methyl)(ethyl)amine, 95%, ((2,4-Dichlorophenyl)(pyridin-3-yl)methyl)(ethyl)amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-[(2,4-dichlorophenyl)-pyridin-3-ylmethyl]ethanamine (CAS 1304390-10-0) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: N-[(2,4-dichlorophenyl)-pyridin-3-ylmethyl]ethanamine. InChIKey: BIGHARZXRMFHIB-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | N-[(2,4-dichlorophenyl)-pyridin-3-ylmethyl]ethanamine |
| InChIKey | BIGHARZXRMFHIB-UHFFFAOYSA-N |
| SMILES | CCNC(C1=CN=CC=C1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)