Products 1807752-97-1
CAS 1807752-97-1 is the registry number for 2,5-Dichloro-N-mesitylpyridin-3-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2,5-dichloro-N-(2,4,6-trimethylphenyl)pyridin-3-amine (CAS 1807752-97-1) is a chemical compound with the molecular formula C14H14Cl2N2 and a molecular weight of 281.2 g/mol. IUPAC name: 2,5-dichloro-N-(2,4,6-trimethylphenyl)pyridin-3-amine. InChIKey: REGLIPRTWOHJTE-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2N2 |
|---|---|
| Molecular weight | 281.2 g/mol |
| IUPAC name | 2,5-dichloro-N-(2,4,6-trimethylphenyl)pyridin-3-amine |
| InChIKey | REGLIPRTWOHJTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC2=C(N=CC(=C2)Cl)Cl)C |
Computed by PubChem (NCBI)