CAS 10198-77-3 is the registry number for 4,6-Dichloro-5-methyl-2-(pyridin-2-yl)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,6-dichloro-5-methyl-2-pyridin-2-ylpyrimidine (CAS 10198-77-3) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 4,6-dichloro-5-methyl-2-pyridin-2-ylpyrimidine. InChIKey: GKQVGLLABJUKGW-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 4,6-dichloro-5-methyl-2-pyridin-2-ylpyrimidine |
| InChIKey | GKQVGLLABJUKGW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1Cl)C2=CC=CC=N2)Cl |
Computed by PubChem (NCBI)