CAS 1239850-50-0 is the registry number for 4,5-Dichloro-6-methyl-2-pyridin-4-ylpyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,5-dichloro-6-methyl-2-pyridin-4-ylpyrimidine (CAS 1239850-50-0) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 4,5-dichloro-6-methyl-2-pyridin-4-ylpyrimidine. InChIKey: BXTHLPHLDCDQHL-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 4,5-dichloro-6-methyl-2-pyridin-4-ylpyrimidine |
| InChIKey | BXTHLPHLDCDQHL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)C2=CC=NC=C2)Cl)Cl |
Computed by PubChem (NCBI)