CAS 828273-03-6 is the registry number for 4-(2,4-Dichlorophenyl)pyrimidin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2,4-dichlorophenyl)pyrimidin-2-amine (CAS 828273-03-6) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)pyrimidin-2-amine. InChIKey: IIQPBSILLIMQBY-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)pyrimidin-2-amine |
| InChIKey | IIQPBSILLIMQBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=NC=C2)N |
Computed by PubChem (NCBI)