CAS 392307-26-5 is the registry number for 2-Amino-4-(3,4-dichlorophenyl)pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-dichlorophenyl)pyrimidin-2-amine (CAS 392307-26-5) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)pyrimidin-2-amine. InChIKey: RFJCMVZTLPFZED-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)pyrimidin-2-amine |
| InChIKey | RFJCMVZTLPFZED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC(=NC=C2)N)Cl)Cl |
Computed by PubChem (NCBI)