CAS 260045-66-7 appears in our catalog under these names: 2-Chloro-n-(3-chlorophenyl)pyrimidin-4-amine, 95%, 2–Chloro–N–(3–Chlorophenyl)Pyrimidin–4–Amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-chloro-N-(3-chlorophenyl)pyrimidin-4-amine (CAS 260045-66-7) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 2-chloro-N-(3-chlorophenyl)pyrimidin-4-amine. InChIKey: CHNMIOTYEQOALT-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 2-chloro-N-(3-chlorophenyl)pyrimidin-4-amine |
| InChIKey | CHNMIOTYEQOALT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)