Products 28230-47-9
CAS 28230-47-9 is the registry number for 2,6-Dichloro-N-phenylpyrimidin-4-amine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-N-phenylpyrimidin-4-amine (CAS 28230-47-9) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 2,6-dichloro-N-phenylpyrimidin-4-amine. InChIKey: WKVVPGGJSMZBKK-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 2,6-dichloro-N-phenylpyrimidin-4-amine |
| InChIKey | WKVVPGGJSMZBKK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)