CAS 26650-79-3 appears in our catalog under these names: 2-Benzyl-4,6-dichloro-1,3,5-triazine, 95%, 2-Benzyl-4,6-dichloro-1,3,5-triazine, 97%, 2-Benzyl-4,6-dichloro-1,3,5-triazine, 98%, 98%, 2-BENZYL-4,6-DICHLORO-1,3,5-TRIAZINE, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-benzyl-4,6-dichloro-1,3,5-triazine (CAS 26650-79-3) is a chemical compound with the molecular formula C10H7Cl2N3 and a molecular weight of 240.09 g/mol. IUPAC name: 2-benzyl-4,6-dichloro-1,3,5-triazine. InChIKey: HLHINYIRBZWBEF-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N3 |
|---|---|
| Molecular weight | 240.09 g/mol |
| IUPAC name | 2-benzyl-4,6-dichloro-1,3,5-triazine |
| InChIKey | HLHINYIRBZWBEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)