CAS 1020040-14-5 is the registry number for 1-(2-Chloro-6-fluorophenyl)butane-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2-chloro-6-fluorophenyl)butane-1,3-dione (CAS 1020040-14-5) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 1-(2-chloro-6-fluorophenyl)butane-1,3-dione. InChIKey: ORIDGQVSKPBTRN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 1-(2-chloro-6-fluorophenyl)butane-1,3-dione |
| InChIKey | ORIDGQVSKPBTRN-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=C(C=CC=C1Cl)F |
Computed by PubChem (NCBI)