Products 2227899-38-7
CAS 2227899-38-7 appears in our catalog under these names: trans–2–(3–chloro–5–fluorophenyl)cyclopropane–1–carboxylic acid, rac-(1R,2R)-2-(3-chloro-5-fluorophenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g.
Trans-(1R,2R)-2-(3-chloro-5-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 2227899-38-7) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: trans-(1R,2R)-2-(3-chloro-5-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: RNQXIRVGVKKDHI-DTWKUNHWSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3-chloro-5-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | RNQXIRVGVKKDHI-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=CC(=C2)Cl)F |
Computed by PubChem (NCBI)