CAS 1268444-83-2 appears in our catalog under these names: 1-(4-Chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 1-(4-Chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid, 1-(4-Chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 98%, 1-(4-CHLORO-3-FLUOROPHENYL)CYCLOPROPANECARBOXYLIC ACID, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg, 5g.
1-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 1268444-83-2) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: SCLMZYVNTVEMGB-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | SCLMZYVNTVEMGB-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)