Products 1453211-51-2
CAS 1453211-51-2 is the registry number for 2-Chloro-3-ethynyl-4-fluoro-1,5-dimethoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3-ethynyl-4-fluoro-1,5-dimethoxybenzene (CAS 1453211-51-2) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 2-chloro-3-ethynyl-4-fluoro-1,5-dimethoxybenzene. InChIKey: RLRLIZSRDKRKAS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 2-chloro-3-ethynyl-4-fluoro-1,5-dimethoxybenzene |
| InChIKey | RLRLIZSRDKRKAS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1F)C#C)Cl)OC |
Computed by PubChem (NCBI)