CAS 869970-64-9 appears in our catalog under these names: 1-(4-Chloro-2-fluorophenyl)cyclopropanecarboxylic acid, 98%, 1–(4–chloro–2–fluorophenyl)cyclopropane–1–carboxylic acid, 1-(4-Chloro-2-fluorophenyl)cyclopropane-1-carboxylic acid, 1-(4-chloro-2-fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 98%, Cyclopropanecarboxylic acid, 1-(4-chloro-2-fluorophenyl)-, 98%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,5g, 100mg.
1-(4-chloro-2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 869970-64-9) is a chemical compound with the molecular formula C10H8ClFO2 and a molecular weight of 214.62 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: REFBTNOOKKSXRG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFO2 |
|---|---|
| Molecular weight | 214.62 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | REFBTNOOKKSXRG-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=C(C=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)