Products 1020252-63-4

CAS 1020252-63-4 is the registry number for methyl 2-(3-(3-nitrophenyl)prop-2-enoylamino)acetate. Offered by: Biosynth. Available pack sizes: 2g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate (CAS 1020252-63-4) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate. InChIKey: LYENPTUEHAKQOP-AATRIKPKSA-N.

Identity
Molecular formulaC12H12N2O5
Molecular weight264.23 g/mol
IUPAC namemethyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate
InChIKeyLYENPTUEHAKQOP-AATRIKPKSA-N
SMILESCOC(=O)CNC(=O)/C=C/C1=CC(=CC=C1)[N+](=O)[O-]

Computed by PubChem (NCBI)