CAS 1020252-63-4 is the registry number for methyl 2-(3-(3-nitrophenyl)prop-2-enoylamino)acetate. Offered by: Biosynth. Available pack sizes: 2g, 1g.
Methyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate (CAS 1020252-63-4) is a chemical compound with the molecular formula C12H12N2O5 and a molecular weight of 264.23 g/mol. IUPAC name: methyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate. InChIKey: LYENPTUEHAKQOP-AATRIKPKSA-N.
| Molecular formula | C12H12N2O5 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | methyl 2-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]amino]acetate |
| InChIKey | LYENPTUEHAKQOP-AATRIKPKSA-N |
| SMILES | COC(=O)CNC(=O)/C=C/C1=CC(=CC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)