Products 1020636-10-5
CAS 1020636-10-5 is the registry number for Ethyl 3-(2,5-dichloropyridin-4-yl)-3-oxopropionoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(2,5-dichloro-4-pyridinyl)-3-oxopropanoate (CAS 1020636-10-5) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: ethyl 3-(2,5-dichloro-4-pyridinyl)-3-oxopropanoate. InChIKey: BALOBIFASPWUDK-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | ethyl 3-(2,5-dichloro-4-pyridinyl)-3-oxopropanoate |
| InChIKey | BALOBIFASPWUDK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=NC=C1Cl)Cl |
Computed by PubChem (NCBI)