CAS 91587-41-6 appears in our catalog under these names: 2-Chloro-5-([(chloroacetyl)amino]methyl)benzoic acid, 95%, 2-Chloro-5-((2-chloroacetamido)methyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-chloro-5-[[(2-chloroacetyl)amino]methyl]benzoic acid (CAS 91587-41-6) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: 2-chloro-5-[[(2-chloroacetyl)amino]methyl]benzoic acid. InChIKey: MQGBVNVKAFJSAD-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-chloro-5-[[(2-chloroacetyl)amino]methyl]benzoic acid |
| InChIKey | MQGBVNVKAFJSAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CNC(=O)CCl)C(=O)O)Cl |
Computed by PubChem (NCBI)