CAS 926248-83-1 is the registry number for N-(3,4-Dichlorobenzoyl)-beta-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-[(3,4-dichlorobenzoyl)amino]propanoic acid (CAS 926248-83-1) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: 3-[(3,4-dichlorobenzoyl)amino]propanoic acid. InChIKey: PXDUKUMEEJVPIQ-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 3-[(3,4-dichlorobenzoyl)amino]propanoic acid |
| InChIKey | PXDUKUMEEJVPIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NCCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)