CAS 1396978-97-4 is the registry number for 2-((2,3-Dichlorophenyl)formamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2,3-dichlorobenzoyl)amino]propanoic acid (CAS 1396978-97-4) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: 2-[(2,3-dichlorobenzoyl)amino]propanoic acid. InChIKey: DSSCFIPJBPCSNQ-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-[(2,3-dichlorobenzoyl)amino]propanoic acid |
| InChIKey | DSSCFIPJBPCSNQ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)