Products 52715-67-0
CAS 52715-67-0 appears in our catalog under these names: 3-(3,4-Dichlorophenyl)-2-formamidopropanoic acid, 95%, 3-(3,4-Dichlorophenyl)-2-formamidopropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3-(3,4-dichlorophenyl)-2-formamidopropanoic acid (CAS 52715-67-0) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-2-formamidopropanoic acid. InChIKey: IWOAYRKLPJZPSA-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-2-formamidopropanoic acid |
| InChIKey | IWOAYRKLPJZPSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)NC=O)Cl)Cl |
Computed by PubChem (NCBI)