CAS 941055-93-2 is the registry number for 2-Chloro-N-(7-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide (CAS 941055-93-2) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: 2-chloro-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide. InChIKey: QRGBGJCLKIHNHF-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 2-chloro-N-(6-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)acetamide |
| InChIKey | QRGBGJCLKIHNHF-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C(C(=C2)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)