Products 338965-44-9
CAS 338965-44-9 is the registry number for Methyl 2-[(2,5-dichlorophenyl)formamido]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2-[(2,5-dichlorobenzoyl)amino]acetate (CAS 338965-44-9) is a chemical compound with the molecular formula C10H9Cl2NO3 and a molecular weight of 262.09 g/mol. IUPAC name: methyl 2-[(2,5-dichlorobenzoyl)amino]acetate. InChIKey: HEQMQHUYOUBUKR-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO3 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | methyl 2-[(2,5-dichlorobenzoyl)amino]acetate |
| InChIKey | HEQMQHUYOUBUKR-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)