CAS 1020719-03-2 is the registry number for 2–Amino–3–((methyl–d3)amino)–5–phenylpyridine. Offered by: GLPBio. Available pack sizes: 10mg.
5-phenyl-3-N-(trideuteriomethyl)pyridine-2,3-diamine (CAS 1020719-03-2) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 202.27 g/mol. IUPAC name: 5-phenyl-3-N-(trideuteriomethyl)pyridine-2,3-diamine. InChIKey: ZZARKLLLBRWNNV-FIBGUPNXSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 5-phenyl-3-N-(trideuteriomethyl)pyridine-2,3-diamine |
| InChIKey | ZZARKLLLBRWNNV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(N=CC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)