CAS 107351-81-5 is the registry number for 2-Amino-3-methylamino-5-phenylpyridine. Offered by: TRC. Available pack sizes: 500mg, 50mg.
3-N-methyl-5-phenylpyridine-2,3-diamine (CAS 107351-81-5) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-N-methyl-5-phenylpyridine-2,3-diamine. InChIKey: ZZARKLLLBRWNNV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-N-methyl-5-phenylpyridine-2,3-diamine |
| InChIKey | ZZARKLLLBRWNNV-UHFFFAOYSA-N |
| SMILES | CNC1=C(N=CC(=C1)C2=CC=CC=C2)N |
Computed by PubChem (NCBI)