CAS 1020719-52-1 appears in our catalog under these names: 5-Hydroxymethyl-N-phenyl-2-1H-pyridone-d5, 5-(Hydroxymethyl)-1-phenylpyridin-2(1H)-one-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
5-(hydroxymethyl)-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one (CAS 1020719-52-1) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 206.25 g/mol. IUPAC name: 5-(hydroxymethyl)-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one. InChIKey: YLTGBKWRQSGNOI-RALIUCGRSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 206.25 g/mol |
| IUPAC name | 5-(hydroxymethyl)-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one |
| InChIKey | YLTGBKWRQSGNOI-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C=C(C=CC2=O)CO)[2H])[2H] |
Computed by PubChem (NCBI)