CAS 887406-49-7 appears in our catalog under these names: Pirfenidone Impurity 6, 5-Hydroxymethyl-N-phenyl-2-1H-pyridone, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
5-(hydroxymethyl)-1-phenylpyridin-2-one (CAS 887406-49-7) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 5-(hydroxymethyl)-1-phenylpyridin-2-one. InChIKey: YLTGBKWRQSGNOI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 5-(hydroxymethyl)-1-phenylpyridin-2-one |
| InChIKey | YLTGBKWRQSGNOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=CC2=O)CO |
Computed by PubChem (NCBI)