CAS 1020724-32-6 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid, 95%, 1-(3,4-Dichlorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(3,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 1020724-32-6) is a chemical compound with the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: GYHJSMVXSOHEEQ-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2O2 |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-5-methylpyrazole-3-carboxylic acid |
| InChIKey | GYHJSMVXSOHEEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)