CAS 1021021-75-9 appears in our catalog under these names: 6-Bromo-3-hydroxy-2,3-dihydro-1H-indol-2-one, 6-Bromo-3-hydroxy-2,3-dihydro-1H-indol-2-one, 95%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-bromo-3-hydroxy-1,3-dihydroindol-2-one (CAS 1021021-75-9) is a chemical compound with the molecular formula C8H6BrNO2 and a molecular weight of 228.04 g/mol. IUPAC name: 6-bromo-3-hydroxy-1,3-dihydroindol-2-one. InChIKey: VXOHMTIZHYANEN-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO2 |
|---|---|
| Molecular weight | 228.04 g/mol |
| IUPAC name | 6-bromo-3-hydroxy-1,3-dihydroindol-2-one |
| InChIKey | VXOHMTIZHYANEN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C2O |
Computed by PubChem (NCBI)