CAS 1021036-78-1 is the registry number for 2,2-Difluoro-n-methyl-2h-1,3-benzodioxol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,2-difluoro-N-methyl-1,3-benzodioxol-5-amine (CAS 1021036-78-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2,2-difluoro-N-methyl-1,3-benzodioxol-5-amine. InChIKey: ZMTHAVDWXFWPQI-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2,2-difluoro-N-methyl-1,3-benzodioxol-5-amine |
| InChIKey | ZMTHAVDWXFWPQI-UHFFFAOYSA-N |
| SMILES | CNC1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)