CAS 1021043-31-1 appears in our catalog under these names: 3-Chloro-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid, 95%, 3-Chloro-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-chloro-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 1021043-31-1) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 3-chloro-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: GSKUFMZZSWYIFW-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO3 |
|---|---|
| Molecular weight | 255.58 g/mol |
| IUPAC name | 3-chloro-6-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | GSKUFMZZSWYIFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(=O)O)OCC(F)(F)F |
Computed by PubChem (NCBI)