Products 2007153-15-1
CAS 2007153-15-1 is the registry number for 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethan-1-ol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanol (CAS 2007153-15-1) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanol. InChIKey: QPXUZCWKKJMIDV-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO3 |
|---|---|
| Molecular weight | 255.58 g/mol |
| IUPAC name | 1-(2-chloro-5-nitrophenyl)-2,2,2-trifluoroethanol |
| InChIKey | QPXUZCWKKJMIDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)