Products 953729-63-0

CAS 953729-63-0 appears in our catalog under these names: 5-Chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid, 95%, 5-Chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid (CAS 953729-63-0) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 5-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid. InChIKey: JRQLNFZESQUFOU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF3NO3
Molecular weight255.58 g/mol
IUPAC name5-chloro-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxylic acid
InChIKeyJRQLNFZESQUFOU-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Cl)OCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)