Products 851208-01-0

CAS 851208-01-0 is the registry number for [3-Chloro-2-oxo-5-(trifluoromethyl)pyridin-1(2h)-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetic acid (CAS 851208-01-0) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetic acid. InChIKey: DMFPEEFRMXLMLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF3NO3
Molecular weight255.58 g/mol
IUPAC name2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetic acid
InChIKeyDMFPEEFRMXLMLJ-UHFFFAOYSA-N
SMILESC1=C(C(=O)N(C=C1C(F)(F)F)CC(=O)O)Cl

Computed by PubChem (NCBI)