CAS 2092933-17-8 is the registry number for 1-chloro-3-nitro-5-(2,2,2-trifluoroethoxy)benzene, 96%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-chloro-3-nitro-5-(2,2,2-trifluoroethoxy)benzene (CAS 2092933-17-8) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 1-chloro-3-nitro-5-(2,2,2-trifluoroethoxy)benzene. InChIKey: FDWYDUYVJRYJCX-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO3 |
|---|---|
| Molecular weight | 255.58 g/mol |
| IUPAC name | 1-chloro-3-nitro-5-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | FDWYDUYVJRYJCX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OCC(F)(F)F)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)