CAS 855916-43-7 is the registry number for 6-Chloro-5-(2,2,2-trifluoroethoxy)picolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 855916-43-7) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: WZTGMRHCVLRAEZ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO3 |
|---|---|
| Molecular weight | 255.58 g/mol |
| IUPAC name | 6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid |
| InChIKey | WZTGMRHCVLRAEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1OCC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)