Products 855916-43-7

CAS 855916-43-7 is the registry number for 6-Chloro-5-(2,2,2-trifluoroethoxy)picolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.

Structural formula: {0} (CAS {1})

6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid (CAS 855916-43-7) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid. InChIKey: WZTGMRHCVLRAEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF3NO3
Molecular weight255.58 g/mol
IUPAC name6-chloro-5-(2,2,2-trifluoroethoxy)pyridine-2-carboxylic acid
InChIKeyWZTGMRHCVLRAEZ-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1OCC(F)(F)F)Cl)C(=O)O

Computed by PubChem (NCBI)