Products 883950-09-2
CAS 883950-09-2 appears in our catalog under these names: 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid, 95%, 95%, 2-Chloro-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid (CAS 883950-09-2) is a chemical compound with the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. IUPAC name: 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid. InChIKey: FVHKOLLQKHIDJS-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO3 |
|---|---|
| Molecular weight | 255.58 g/mol |
| IUPAC name | 2-chloro-6-(2,2,2-trifluoroethoxy)pyridine-4-carboxylic acid |
| InChIKey | FVHKOLLQKHIDJS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1OCC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)