CAS 102113-98-4 appears in our catalog under these names: Bis(4-biphenylyl)amine, 98%, 98%, Bis(4–biphenylyl)amine, Bis(4-biphenylyl)amine, >98.0%(GC), Bis-biphenyl-4-yl-amine, 97%, Bis-biphenyl-4-yl-amine 97%. Offered by: Chemat, GLPBio, TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g.
4-phenyl-N-(4-phenylphenyl)aniline (CAS 102113-98-4) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 4-phenyl-N-(4-phenylphenyl)aniline. InChIKey: JAUCIDPGGHZXRP-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-phenyl-N-(4-phenylphenyl)aniline |
| InChIKey | JAUCIDPGGHZXRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)