CAS 343239-58-7 appears in our catalog under these names: 5'–Phenyl–(1,1':3',1''–terphenyl)–4–amine, 5'-Phenyl-[1,1':3',1''-terphenyl]-4-amine, >98.0%(HPLC), [1,1':3',1''-Terphenyl]-4-amine, 5'-phenyl- (9CI), 98%, 98%, 5'-Phenyl-[1,1':3',1''-terphenyl]-4-amine, 98%, 5'-Phenyl-[1,1':3',1''-terphenyl]-4-amine, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g.
4-(3,5-diphenylphenyl)aniline (CAS 343239-58-7) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 4-(3,5-diphenylphenyl)aniline. InChIKey: MSSVJLBZMVKSHM-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-(3,5-diphenylphenyl)aniline |
| InChIKey | MSSVJLBZMVKSHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)