CAS 169224-65-1 appears in our catalog under these names: Bis(3-biphenylyl)amine, 95%, Di((1,1'-biphenyl)-3-yl)amine, 98%, Bis(3–biphenylyl)amine, Bis(3-biphenylyl)amine, >98.0%(HPLC)(N), Di([1,1'-biphenyl]-3-yl)amine, 99%+, 99%+. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg, 250mg, 100mg, 5g, 10g, 25g, 50g.
3-phenyl-N-(3-phenylphenyl)aniline (CAS 169224-65-1) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 3-phenyl-N-(3-phenylphenyl)aniline. InChIKey: LXOCTSJQHHCASE-UHFFFAOYSA-N.
| Molecular formula | C24H19N |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 3-phenyl-N-(3-phenylphenyl)aniline |
| InChIKey | LXOCTSJQHHCASE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC=CC(=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)