Products 787500-74-7

CAS 787500-74-7 is the registry number for [1,1':2',1'':2'',1'''-Quaterphenyl]-2-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2-[2-(2-phenylphenyl)phenyl]aniline (CAS 787500-74-7) is a chemical compound with the molecular formula C24H19N and a molecular weight of 321.4 g/mol. IUPAC name: 2-[2-(2-phenylphenyl)phenyl]aniline. InChIKey: VIKQYNAUXZAYKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC24H19N
Molecular weight321.4 g/mol
IUPAC name2-[2-(2-phenylphenyl)phenyl]aniline
InChIKeyVIKQYNAUXZAYKJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=CC=C2C3=CC=CC=C3C4=CC=CC=C4N

Computed by PubChem (NCBI)